EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,17-18,20-24,31-33H,8-16H2,1-6H3,(H,34,35)/t17-,18+,20-,21-,22-,23+,24-,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | JXSVIVRDWWRQRT-SVOQGVCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans sinensis (ncbitaxon:442437-1) | |||
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α,3α,23-trihydroxyurs-12-en-28-oic acid (CHEBI:67950) has parent hydride ursane (CHEBI:35711) |
| 2α,3α,23-trihydroxyurs-12-en-28-oic acid (CHEBI:67950) has role plant metabolite (CHEBI:76924) |
| 2α,3α,23-trihydroxyurs-12-en-28-oic acid (CHEBI:67950) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2α,3α,23-trihydroxyurs-12-en-28-oic acid (CHEBI:67950) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 2α,3α,23-trihydroxyurs-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5486579 | Reaxys |
| Citations |
|---|