EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C(=O)C[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O5/c1-25(2)11-13-30(24(34)35)14-12-27(4)18(19(30)16-25)7-8-21-28(27,5)10-9-20-26(3,17-31)22(32)15-23(33)29(20,21)6/h7,19-22,31-32H,8-17H2,1-6H3,(H,34,35)/t19-,20-,21-,22-,26-,27+,28+,29-,30-/m0/s1 |
| InChIKey | BYWZDPHXZQSASO-DLRRJOOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans sinensis (ncbitaxon:442437-1) | |||
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-oxo-3β,23-dihydroxyolean-12-en-28-oic acid (CHEBI:67946) has parent hydride oleanane (CHEBI:36481) |
| 1-oxo-3β,23-dihydroxyolean-12-en-28-oic acid (CHEBI:67946) has role plant metabolite (CHEBI:76924) |
| 1-oxo-3β,23-dihydroxyolean-12-en-28-oic acid (CHEBI:67946) is a cyclic terpene ketone (CHEBI:36130) |
| 1-oxo-3β,23-dihydroxyolean-12-en-28-oic acid (CHEBI:67946) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 1-oxo-3β,23-dihydroxyolean-12-en-28-oic acid (CHEBI:67946) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 3β,23-dihydroxy-1-oxoolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9459129 | Reaxys |
| Citations |
|---|