EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC(=O)[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-25(2)12-14-30(24(33)34)15-13-27(5)18(19(30)17-25)8-9-21-28(27,6)11-10-20-26(3,4)22(31)16-23(32)29(20,21)7/h8,19-22,31H,9-17H2,1-7H3,(H,33,34)/t19-,20-,21-,22-,27+,28+,29-,30-/m0/s1 |
| InChIKey | IZWBODJDDBCDFA-DXEZAUPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans sinensis (ncbitaxon:442437-1) | |||
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| virgatic acid (CHEBI:67945) has parent hydride oleanane (CHEBI:36481) |
| virgatic acid (CHEBI:67945) has role plant metabolite (CHEBI:76924) |
| virgatic acid (CHEBI:67945) is a cyclic terpene ketone (CHEBI:36130) |
| virgatic acid (CHEBI:67945) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| virgatic acid (CHEBI:67945) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 3β-hydroxy-1-oxoolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7359063 | Reaxys |
| Citations |
|---|