EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12CC[C@]3([H])C4=CC(C)(C)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC(=O)[C@]21C |
| InChI | InChI=1S/C30H48O2/c1-25(2)13-14-27(5)15-16-28(6)19(20(27)18-25)9-10-22-29(28,7)12-11-21-26(3,4)23(31)17-24(32)30(21,22)8/h18-19,21-23,31H,9-17H2,1-8H3/t19-,21+,22+,23+,27-,28-,29-,30+/m1/s1 |
| InChIKey | PKZZYOJERITBAM-HBSCMMAFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans sinensis (ncbitaxon:442437-1) | |||
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-oxo-3β-hydroxyolean-18-ene (CHEBI:67942) has parent hydride oleanane (CHEBI:36481) |
| 1-oxo-3β-hydroxyolean-18-ene (CHEBI:67942) has role plant metabolite (CHEBI:76924) |
| 1-oxo-3β-hydroxyolean-18-ene (CHEBI:67942) is a cyclic terpene ketone (CHEBI:36130) |
| 1-oxo-3β-hydroxyolean-18-ene (CHEBI:67942) is a pentacyclic triterpenoid (CHEBI:25872) |
| 1-oxo-3β-hydroxyolean-18-ene (CHEBI:67942) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 3β-hydroxyolean-18-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448535 | Reaxys |
| Citations |
|---|