EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O12 |
| Net Charge | 0 |
| Average Mass | 478.406 |
| Monoisotopic Mass | 478.11113 |
| SMILES | COc1c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c2c1=O |
| InChI | InChI=1S/C22H22O12/c1-31-21-17(28)15-12(26)5-9(32-22-19(30)18(29)16(27)14(7-23)34-22)6-13(15)33-20(21)8-2-3-10(24)11(25)4-8/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18+,19-,22-/m1/s1 |
| InChIKey | LKXBGSZMRNJAST-UKWZQOBBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-methylquercetin-7-O-β-D-glucopyranoside (CHEBI:67937) has role metabolite (CHEBI:25212) |
| 3-O-methylquercetin-7-O-β-D-glucopyranoside (CHEBI:67937) has role plant metabolite (CHEBI:76924) |
| 3-O-methylquercetin-7-O-β-D-glucopyranoside (CHEBI:67937) is a monosaccharide derivative (CHEBI:63367) |
| 3-O-methylquercetin-7-O-β-D-glucopyranoside (CHEBI:67937) is a quercetin O-glucoside (CHEBI:64621) |
| 3-O-methylquercetin-7-O-β-D-glucopyranoside (CHEBI:67937) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-3-methoxy-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| transilin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1277270 | Reaxys |
| Citations |
|---|