EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H34O18 |
| Net Charge | 0 |
| Average Mass | 742.639 |
| Monoisotopic Mass | 742.17451 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2c(-c3ccc(OC(C)=O)cc3)oc3cc(OC(C)=O)cc(OC(C)=O)c3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H34O18/c1-15(36)44-14-27-31(48-19(5)40)33(49-20(6)41)34(50-21(7)42)35(52-27)53-32-29(43)28-25(47-18(4)39)12-24(46-17(3)38)13-26(28)51-30(32)22-8-10-23(11-9-22)45-16(2)37/h8-13,27,31,33-35H,14H2,1-7H3/t27-,31-,33+,34-,35+/m1/s1 |
| InChIKey | XNIDEUYQVRRKJJ-FZPNTLRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astragalin heptaacetate (CHEBI:67927) has functional parent kaempferol 3-O-β-D-glucoside (CHEBI:30200) |
| astragalin heptaacetate (CHEBI:67927) has role metabolite (CHEBI:25212) |
| astragalin heptaacetate (CHEBI:67927) has role plant metabolite (CHEBI:76924) |
| astragalin heptaacetate (CHEBI:67927) has role trypanocidal drug (CHEBI:36335) |
| astragalin heptaacetate (CHEBI:67927) is a acetate ester (CHEBI:47622) |
| astragalin heptaacetate (CHEBI:67927) is a kaempferol O-glucoside (CHEBI:64634) |
| astragalin heptaacetate (CHEBI:67927) is a monosaccharide derivative (CHEBI:63367) |
| astragalin heptaacetate (CHEBI:67927) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-[4-(acetyloxy)phenyl]-4-oxo-3-[(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)oxy]-4H-chromene-5,7-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:77909 | Reaxys |
| Citations |
|---|