EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H34O18 |
| Net Charge | 0 |
| Average Mass | 742.639 |
| Monoisotopic Mass | 742.17451 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2c(-c3ccc(OC(C)=O)cc3)oc3cc(OC(C)=O)cc(OC(C)=O)c3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H34O18/c1-15(36)44-14-27-31(48-19(5)40)33(49-20(6)41)34(50-21(7)42)35(52-27)53-32-29(43)28-25(47-18(4)39)12-24(46-17(3)38)13-26(28)51-30(32)22-8-10-23(11-9-22)45-16(2)37/h8-13,27,31,33-35H,14H2,1-7H3/t27-,31-,33+,34-,35+/m1/s1 |
| InChIKey | XNIDEUYQVRRKJJ-FZPNTLRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astragalin heptaacetate (CHEBI:67927) has functional parent kaempferol 3-O-β-D-glucoside (CHEBI:30200) |
| astragalin heptaacetate (CHEBI:67927) has role metabolite (CHEBI:25212) |
| astragalin heptaacetate (CHEBI:67927) has role plant metabolite (CHEBI:76924) |
| astragalin heptaacetate (CHEBI:67927) has role trypanocidal drug (CHEBI:36335) |
| astragalin heptaacetate (CHEBI:67927) is a acetate ester (CHEBI:47622) |
| astragalin heptaacetate (CHEBI:67927) is a kaempferol O-glucoside (CHEBI:64634) |
| astragalin heptaacetate (CHEBI:67927) is a monosaccharide derivative (CHEBI:63367) |
| astragalin heptaacetate (CHEBI:67927) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-[4-(acetyloxy)phenyl]-4-oxo-3-[(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)oxy]-4H-chromene-5,7-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:77909 | Reaxys |
| Citations |
|---|