EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O12 |
| Net Charge | 0 |
| Average Mass | 490.417 |
| Monoisotopic Mass | 490.11113 |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H22O12/c1-9(25)32-22-19(31)17(29)15(8-24)34-23(22)35-21-18(30)16-13(28)6-12(27)7-14(16)33-20(21)10-2-4-11(26)5-3-10/h2-7,15,17,19,22-24,26-29,31H,8H2,1H3/t15-,17-,19+,22-,23+/m1/s1 |
| InChIKey | MWEQHAGXLGTSKL-OPCQMSRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2''-acetylastragalin (CHEBI:67926) has functional parent kaempferol 3-O-β-D-glucoside (CHEBI:30200) |
| 2''-acetylastragalin (CHEBI:67926) has role plant metabolite (CHEBI:76924) |
| 2''-acetylastragalin (CHEBI:67926) has role trypanocidal drug (CHEBI:36335) |
| 2''-acetylastragalin (CHEBI:67926) is a acetate ester (CHEBI:47622) |
| 2''-acetylastragalin (CHEBI:67926) is a kaempferol O-glucoside (CHEBI:64634) |
| 2''-acetylastragalin (CHEBI:67926) is a monosaccharide derivative (CHEBI:63367) |
| 2''-acetylastragalin (CHEBI:67926) is a trihydroxyflavone (CHEBI:27116) |
| 2''-acetylastragalin (CHEBI:67926) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-acetyl-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21451710 | Reaxys |
| Citations |
|---|