EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5186 - fucoxanthin
| Formula | C42H58O6 |
| Net Charge | 0 |
| Average Mass | 658.920 |
| Monoisotopic Mass | 658.42334 |
| SMILES | [H]C(=C=C1C(C)(C)C[C@H](OC(C)=O)C[C@@]1(C)O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)C(=O)C[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23-,34-,35-,40+,41+,42-/m0/s1 |
| InChIKey | SJWWTRQNNRNTPU-XJUZQKKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystoseira barbata (ncbitaxon:590725) | - | PubMed (28389351) | |
| Himanthalia elongata (ncbitaxon:74478) | - | PubMed (28865626) | |
| Phaeodactylum tricornutum (ncbitaxon:2850) | - | PubMed (27455130) | |
| Saccharina japonica (ncbitaxon:88149) | - | PubMed (28212270) | |
| Sargassum fusiforme (ncbitaxon:590727) | - | PubMed (16786166) | |
| Sargassum siliquastrum (ncbitaxon:127572) | - | PubMed (19264501) | |
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | CH2Cl2 extract of freeze-dried brown algae |
| Undaria pinnatifida (ncbitaxon:74381) | - | PubMed (16786166) |
| Roles Classification |
|---|
| Chemical Role: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| Biological Roles: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. CFTR potentiator A membrane transport modulator that restores the chloride ion transport ability of defective cystic fibrosis transmembrane conductance regulator (CFTR) genes. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. hepatoprotective agent Any compound that is able to prevent damage to the liver. hypoglycemic agent A drug which lowers the blood glucose level. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fucoxanthin (CHEBI:5186) has role algal metabolite (CHEBI:84735) |
| fucoxanthin (CHEBI:5186) has role apoptosis inhibitor (CHEBI:68494) |
| fucoxanthin (CHEBI:5186) has role CFTR potentiator (CHEBI:66902) |
| fucoxanthin (CHEBI:5186) has role food antioxidant (CHEBI:77962) |
| fucoxanthin (CHEBI:5186) has role hepatoprotective agent (CHEBI:62868) |
| fucoxanthin (CHEBI:5186) has role hypoglycemic agent (CHEBI:35526) |
| fucoxanthin (CHEBI:5186) has role marine metabolite (CHEBI:76507) |
| fucoxanthin (CHEBI:5186) has role neuroprotective agent (CHEBI:63726) |
| fucoxanthin (CHEBI:5186) has role plant metabolite (CHEBI:76924) |
| fucoxanthin (CHEBI:5186) is a acetate ester (CHEBI:47622) |
| fucoxanthin (CHEBI:5186) is a allenes (CHEBI:37602) |
| fucoxanthin (CHEBI:5186) is a epoxycarotenol (CHEBI:35307) |
| fucoxanthin (CHEBI:5186) is a secondary alcohol (CHEBI:35681) |
| fucoxanthin (CHEBI:5186) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3S,5R,6S,3'S,5'R,6'R)-3,5'-dihydroxy-8-oxo-6',7'-didehydro-5,6-epoxy-5,6,7,8,5',6'-hexahydro-β,β-caroten-3'-yl acetate |
| Synonyms | Source |
|---|---|
| (3S,3'S,5R,5'R,6S,6'R)-3'-(acetyloxy)-6',7'-didehydro-5,6-epoxy-5,5',6,6',7,8-hexahydro-3,5'-dihydroxy-8-oxo-β,β-carotene | ChemIDplus |
| (3'S,5'R,6'R)-3'-acetoxy-5,6-epoxy-3,5'-dihydroxy-6',7'-didehydro-5,6,7,8,5',6'-hexahydro-β,β-caroten-8-one | IUBMB |
| Fucoxanthin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003773 | KNApSAcK |
| C08596 | KEGG COMPOUND |
| LMPR01070300 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6580822 | Reaxys |
| CAS:3351-86-8 | KEGG COMPOUND |
| CAS:3351-86-8 | ChemIDplus |
| Citations |
|---|