EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H58O6 |
| Net Charge | 0 |
| Average Mass | 658.920 |
| Monoisotopic Mass | 658.42334 |
| SMILES | [H]C(=C=C1C(C)(C)C[C@H](OC(C)=O)C[C@@]1(C)O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)C(=O)C[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23-,34-,35-,40+,41+,42-/m0/s1 |
| InChIKey | SJWWTRQNNRNTPU-XJUZQKKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystoseira barbata (ncbitaxon:590725) | - | PubMed (28389351) | |
| Himanthalia elongata (ncbitaxon:74478) | - | PubMed (28865626) | |
| Phaeodactylum tricornutum (ncbitaxon:2850) | - | PubMed (27455130) | |
| Saccharina japonica (ncbitaxon:88149) | - | PubMed (28212270) | |
| Sargassum fusiforme (ncbitaxon:590727) | - | PubMed (16786166) | |
| Sargassum siliquastrum (ncbitaxon:127572) | - | PubMed (19264501) | |
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | CH2Cl2 extract of freeze-dried brown algae |
| Undaria pinnatifida (ncbitaxon:74381) | - | PubMed (16786166) |
| Roles Classification |
|---|
| Chemical Role: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. CFTR potentiator A membrane transport modulator that restores the chloride ion transport ability of defective cystic fibrosis transmembrane conductance regulator (CFTR) genes. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. hypoglycemic agent A drug which lowers the blood glucose level. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fucoxanthin (CHEBI:5186) has role algal metabolite (CHEBI:84735) |
| fucoxanthin (CHEBI:5186) has role apoptosis inhibitor (CHEBI:68494) |
| fucoxanthin (CHEBI:5186) has role CFTR potentiator (CHEBI:66902) |
| fucoxanthin (CHEBI:5186) has role food antioxidant (CHEBI:77962) |
| fucoxanthin (CHEBI:5186) has role hepatoprotective agent (CHEBI:62868) |
| fucoxanthin (CHEBI:5186) has role hypoglycemic agent (CHEBI:35526) |
| fucoxanthin (CHEBI:5186) has role marine metabolite (CHEBI:76507) |
| fucoxanthin (CHEBI:5186) has role neuroprotective agent (CHEBI:63726) |
| fucoxanthin (CHEBI:5186) has role plant metabolite (CHEBI:76924) |
| fucoxanthin (CHEBI:5186) is a acetate ester (CHEBI:47622) |
| fucoxanthin (CHEBI:5186) is a allenes (CHEBI:37602) |
| fucoxanthin (CHEBI:5186) is a epoxycarotenol (CHEBI:35307) |
| fucoxanthin (CHEBI:5186) is a secondary alcohol (CHEBI:35681) |
| fucoxanthin (CHEBI:5186) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3S,5R,6S,3'S,5'R,6'R)-3,5'-dihydroxy-8-oxo-6',7'-didehydro-5,6-epoxy-5,6,7,8,5',6'-hexahydro-β,β-caroten-3'-yl acetate |
| Synonyms | Source |
|---|---|
| (3S,3'S,5R,5'R,6S,6'R)-3'-(acetyloxy)-6',7'-didehydro-5,6-epoxy-5,5',6,6',7,8-hexahydro-3,5'-dihydroxy-8-oxo-β,β-carotene | ChemIDplus |
| (3'S,5'R,6'R)-3'-acetoxy-5,6-epoxy-3,5'-dihydroxy-6',7'-didehydro-5,6,7,8,5',6'-hexahydro-β,β-caroten-8-one | IUBMB |
| Fucoxanthin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003773 | KNApSAcK |
| C08596 | KEGG COMPOUND |
| LMPR01070300 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6580822 | Reaxys |
| CAS:3351-86-8 | KEGG COMPOUND |
| CAS:3351-86-8 | ChemIDplus |
| Citations |
|---|