EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O2 |
| Net Charge | 0 |
| Average Mass | 248.366 |
| Monoisotopic Mass | 248.17763 |
| SMILES | CC(C)=CCC1(CC=C(C)C)C[C@@H](O)C=CC1=O |
| InChI | InChI=1S/C16H24O2/c1-12(2)7-9-16(10-8-13(3)4)11-14(17)5-6-15(16)18/h5-8,14,17H,9-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | DHMJQJOXFBGZRW-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | MeOH extract of freeze-dried brown algae |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| comosone A (CHEBI:67924) has role metabolite (CHEBI:25212) |
| comosone A (CHEBI:67924) is a enol ether (CHEBI:47985) |
| comosone A (CHEBI:67924) is a enone (CHEBI:51689) |
| Synonym | Source |
|---|---|
| (4R)-4-Hydroxy-6,6-bis(3-methyl-2-buten-1-yl)-2-cyclohexen-1-one | ChEBI |
| Citations |
|---|