EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O5 |
| Net Charge | 0 |
| Average Mass | 296.363 |
| Monoisotopic Mass | 296.16237 |
| SMILES | C=CC(C)(C)c1cc(O)c(C(O)C(O)C(C)(C)O)cc1O |
| InChI | InChI=1S/C16H24O5/c1-6-15(2,3)10-8-11(17)9(7-12(10)18)13(19)14(20)16(4,5)21/h6-8,13-14,17-21H,1H2,2-5H3 |
| InChIKey | SLKADURYZNKIRG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | CH2Cl2 extract of freeze-dried brown algae |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| comosusol D (CHEBI:67923) has role metabolite (CHEBI:25212) |
| comosusol D (CHEBI:67923) is a hydroquinones (CHEBI:24646) |
| Synonym | Source |
|---|---|
| 1-[2,5-Dihydroxy-4-(2-methyl-3-buten-2-yl)phenyl]-3-methyl-1,2,3-butanetriol | ChEBI |
| Citations |
|---|