EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O3 |
| Net Charge | 0 |
| Average Mass | 262.349 |
| Monoisotopic Mass | 262.15689 |
| SMILES | CC(C)=CCc1cc(O)cc(/C=C\C(C)(C)O)c1O |
| InChI | InChI=1S/C16H22O3/c1-11(2)5-6-12-9-14(17)10-13(15(12)18)7-8-16(3,4)19/h5,7-10,17-19H,6H2,1-4H3/b8-7- |
| InChIKey | NJQQRKVXFYIZIH-FPLPWBNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | MeOH extract of freeze-dried brown algae |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| comosusol A (CHEBI:67920) has role metabolite (CHEBI:25212) |
| comosusol A (CHEBI:67920) is a hydroquinones (CHEBI:24646) |
| Synonym | Source |
|---|---|
| 2-[(1Z)-3-Hydroxy-3-methyl-1-buten-1-yl]-6-(3-methyl-2-buten-1-yl)-1,4-benzenediol | ChEBI |
| Citations |
|---|