EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O2 |
| Net Charge | 0 |
| Average Mass | 244.334 |
| Monoisotopic Mass | 244.14633 |
| SMILES | C=CC(C)(C)C1=CC(=O)C(CC=C(C)C)=CC1=O |
| InChI | InChI=1S/C16H20O2/c1-6-16(4,5)13-10-14(17)12(9-15(13)18)8-7-11(2)3/h6-7,9-10H,1,8H2,2-5H3 |
| InChIKey | IXIJAOCIIZYSQJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Perithalia capillaris (ncbitaxon:461191) | - | PubMed (21348445) | |
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | CH2Cl2 extract of freeze-dried brown algae |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3-methylbut-2-enyl)-5-(2-methylbut-3-en-2-yl)cyclohexa-2,5-diene-1,4-dione (CHEBI:67919) has role metabolite (CHEBI:25212) |
| 2-(3-methylbut-2-enyl)-5-(2-methylbut-3-en-2-yl)cyclohexa-2,5-diene-1,4-dione (CHEBI:67919) is a prenylquinone (CHEBI:26255) |
| Synonym | Source |
|---|---|
| 2-(2-Methyl-3-buten-2-yl)-5-(3-methyl-2-buten-1-yl)-1,4-benzoquinone | ChEBI |
| Citations |
|---|