EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O |
| Net Charge | 0 |
| Average Mass | 230.351 |
| Monoisotopic Mass | 230.16707 |
| SMILES | C=CC(C)(C)c1ccc(O)c(CC=C(C)C)c1 |
| InChI | InChI=1S/C16H22O/c1-6-16(4,5)14-9-10-15(17)13(11-14)8-7-12(2)3/h6-7,9-11,17H,1,8H2,2-5H3 |
| InChIKey | VOZHPGWGKPWOGA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Perithalia caudata (ncbitaxon:461192) | - | PubMed (21348445) | |
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | Aqueous extract of freeze-dried brown algae |
| Sporochnus pedunculatus (ncbitaxon:112061) | - | PubMed (21348445) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3-methylbut-2-enyl)-4-(2-methylbut-3-en-2-yl)phenol (CHEBI:67918) has role metabolite (CHEBI:25212) |
| 2-(3-methylbut-2-enyl)-4-(2-methylbut-3-en-2-yl)phenol (CHEBI:67918) is a olefinic compound (CHEBI:78840) |
| Synonyms | Source |
|---|---|
| diisoprenyl phenol | ChEBI |
| thiomarinol C | ChEBI |
| Citations |
|---|