EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O5/c1-17-10-13-30(24(33)34)15-14-27(5)18(22(30)29(17,7)35)8-9-21-26(4)16-19(31)23(32)25(2,3)20(26)11-12-28(21,27)6/h8,17,19-23,31-32,35H,9-16H2,1-7H3,(H,33,34)/t17-,19-,20+,21-,22-,23-,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | OXVUXGFZHDKYLS-QUFHAEKXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euscaphis japonica (ncbitaxon:210332) | twig (BTO:0001411) | DOI (10.1021/np1003593) | 95% ethanolic extract of twigs |
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| euscaphic acid (CHEBI:67914) has parent hydride ursane (CHEBI:35711) |
| euscaphic acid (CHEBI:67914) has role plant metabolite (CHEBI:76924) |
| euscaphic acid (CHEBI:67914) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| euscaphic acid (CHEBI:67914) is a pentacyclic triterpenoid (CHEBI:25872) |
| euscaphic acid (CHEBI:67914) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2α,3α)-2,3,19-trihydroxyurs-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| Jacarandic acid | ChemIDplus |
| Tormentic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00019491 | KNApSAcK |
| C17890 | KEGG COMPOUND |
| HMDB0036651 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4912896 | Reaxys |
| CAS:53155-25-2 | KEGG COMPOUND |
| CAS:53155-25-2 | ChemIDplus |
| Citations |
|---|