EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20+,21+,22+,23+,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | RWNHLTKFBKYDOJ-LHFSSXJCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α,3α,23-trihydroxyolean-12-en-28-oic acid (CHEBI:67913) has parent hydride oleanane (CHEBI:36481) |
| 2α,3α,23-trihydroxyolean-12-en-28-oic acid (CHEBI:67913) has role anti-inflammatory agent (CHEBI:67079) |
| 2α,3α,23-trihydroxyolean-12-en-28-oic acid (CHEBI:67913) has role plant metabolite (CHEBI:76924) |
| 2α,3α,23-trihydroxyolean-12-en-28-oic acid (CHEBI:67913) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2α,3α,23-trihydroxyolean-12-en-28-oic acid (CHEBI:67913) is a pentacyclic triterpenoid (CHEBI:25872) |
| 2α,3α,23-trihydroxyolean-12-en-28-oic acid (CHEBI:67913) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2α,3α)-2,3,23-trihydroxyolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3574130 | Reaxys |
| Citations |
|---|