EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O6 |
| Net Charge | 0 |
| Average Mass | 504.708 |
| Monoisotopic Mass | 504.34509 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CCC(C)(C)[C@@H](O)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O6/c1-25(2)11-13-30(24(35)36)14-12-28(5)17(21(30)23(25)34)7-8-20-26(3)15-18(32)22(33)27(4,16-31)19(26)9-10-29(20,28)6/h7,18-23,31-34H,8-16H2,1-6H3,(H,35,36)/t18-,19-,20-,21-,22-,23+,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | IFIQVSCCFRXSJV-OUKLVGNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-2α,3α,19α,23-tetrahydroxyolean-12-en-28-oic acid (CHEBI:67912) has parent hydride oleanane (CHEBI:36481) |
| rel-2α,3α,19α,23-tetrahydroxyolean-12-en-28-oic acid (CHEBI:67912) has role plant metabolite (CHEBI:76924) |
| rel-2α,3α,19α,23-tetrahydroxyolean-12-en-28-oic acid (CHEBI:67912) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| rel-2α,3α,19α,23-tetrahydroxyolean-12-en-28-oic acid (CHEBI:67912) is a pentacyclic triterpenoid (CHEBI:25872) |
| rel-2α,3α,19α,23-tetrahydroxyolean-12-en-28-oic acid (CHEBI:67912) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| rel-(2α,3α,19α)-2,3,19,23-tetrahydroxyolean-12-en-28-oic acid |
| Citations |
|---|