EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CCC3=C4CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)16-25)8-9-22-27(5)17-20(31)23(32)26(3,4)21(27)10-11-29(22,28)7/h20-23,31-32H,8-17H2,1-7H3,(H,33,34)/t20-,21+,22-,23+,27+,28-,29-,30+/m1/s1 |
| InChIKey | HJMFZRRKMVZJCX-JZQYXDLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α,3β-dihydroxyolean-13(18)-en-28-oic acid (CHEBI:67911) has parent hydride oleanane (CHEBI:36481) |
| 2α,3β-dihydroxyolean-13(18)-en-28-oic acid (CHEBI:67911) has role anti-inflammatory agent (CHEBI:67079) |
| 2α,3β-dihydroxyolean-13(18)-en-28-oic acid (CHEBI:67911) has role plant metabolite (CHEBI:76924) |
| 2α,3β-dihydroxyolean-13(18)-en-28-oic acid (CHEBI:67911) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 2α,3β-dihydroxyolean-13(18)-en-28-oic acid (CHEBI:67911) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2α,3β)-2,3-dihydroxyolean-13(18)-en-28-oic acid |
| Citations |
|---|