EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O6 |
| Net Charge | 0 |
| Average Mass | 502.692 |
| Monoisotopic Mass | 502.32944 |
| SMILES | [H][C@]12C=CC3=C[C@@](CC[C@@H](C)C(C)=O)(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O6/c1-18(19(2)32)9-12-30(25(35)36)14-13-28(5)20(15-30)7-8-23-26(3)16-21(33)24(34)27(4,17-31)22(26)10-11-29(23,28)6/h7-8,15,18,21-24,31,33-34H,9-14,16-17H2,1-6H3,(H,35,36)/t18-,21-,22-,23-,24-,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | GASVCOQAHAIPDZ-GUFPWPFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-2α,3α,23-trihydroxy-19-oxo-18,19-seco-urs-11,13(18)-dien-28-oic acid (CHEBI:67909) has role anti-inflammatory agent (CHEBI:67079) |
| rel-2α,3α,23-trihydroxy-19-oxo-18,19-seco-urs-11,13(18)-dien-28-oic acid (CHEBI:67909) has role plant metabolite (CHEBI:76924) |
| rel-2α,3α,23-trihydroxy-19-oxo-18,19-seco-urs-11,13(18)-dien-28-oic acid (CHEBI:67909) is a methyl ketone (CHEBI:51867) |
| rel-2α,3α,23-trihydroxy-19-oxo-18,19-seco-urs-11,13(18)-dien-28-oic acid (CHEBI:67909) is a oxo monocarboxylic acid (CHEBI:35871) |
| rel-2α,3α,23-trihydroxy-19-oxo-18,19-seco-urs-11,13(18)-dien-28-oic acid (CHEBI:67909) is a tetracyclic triterpenoid (CHEBI:26893) |
| rel-2α,3α,23-trihydroxy-19-oxo-18,19-seco-urs-11,13(18)-dien-28-oic acid (CHEBI:67909) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| rel-(2S,4aS,4bR,6aR,7R,8S,9R,10aS,10bR)-8,9-dihydroxy-7-(hydroxymethyl)-4a,4b,7,10a-tetramethyl-2-[(3R)-3-methyl-4-oxopentyl]-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b-tetradecahydrochrysene-2-carboxylic acid |
| Citations |
|---|