EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O4 |
| Net Charge | 0 |
| Average Mass | 458.683 |
| Monoisotopic Mass | 458.33961 |
| SMILES | [H][C@]12CC=C3C=C(CC[C@@H](C)C(C)=O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C29H46O4/c1-18(19(2)31)7-8-20-11-13-28(5)21(15-20)9-10-24-26(3)16-22(32)25(33)27(4,17-30)23(26)12-14-29(24,28)6/h9,15,18,22-25,30,32-33H,7-8,10-14,16-17H2,1-6H3/t18-,22-,23-,24-,25+,26+,27+,28-,29-/m1/s1 |
| InChIKey | CLYJOENFDBUFKF-JAJNDCFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-2α,3β,23-trihydroxy-19-oxo-18,19-seco-12,17-dien-28-norursane (CHEBI:67907) has role anti-inflammatory agent (CHEBI:67079) |
| rel-2α,3β,23-trihydroxy-19-oxo-18,19-seco-12,17-dien-28-norursane (CHEBI:67907) has role plant metabolite (CHEBI:76924) |
| rel-2α,3β,23-trihydroxy-19-oxo-18,19-seco-12,17-dien-28-norursane (CHEBI:67907) is a methyl ketone (CHEBI:51867) |
| rel-2α,3β,23-trihydroxy-19-oxo-18,19-seco-12,17-dien-28-norursane (CHEBI:67907) is a tetracyclic triterpenoid (CHEBI:26893) |
| rel-2α,3β,23-trihydroxy-19-oxo-18,19-seco-12,17-dien-28-norursane (CHEBI:67907) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| rel-(3R)-5-[(4aS,4bR,6aR,7R,8R,9R,10aR,10bR)-8,9-dihydroxy-7-(hydroxymethyl)-4a,4b,7,10a-tetramethyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11-tetradecahydrochrysen-2-yl]-3-methylpentan-2-one |
| Citations |
|---|