EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O8 |
| Net Charge | 0 |
| Average Mass | 432.469 |
| Monoisotopic Mass | 432.17842 |
| SMILES | [H][C@]12C(=O)[C@@H](OC(C)=O)C[C@@H](C(=O)OC)[C@]1(C)CC[C@@]1([H])C(=O)O[C@]([H])(c3ccoc3)C[C@]21C |
| InChI | InChI=1S/C23H28O8/c1-12(24)30-16-9-15(20(26)28-4)22(2)7-5-14-21(27)31-17(13-6-8-29-11-13)10-23(14,3)19(22)18(16)25/h6,8,11,14-17,19H,5,7,9-10H2,1-4H3/t14-,15-,16-,17-,19-,22-,23-/m0/s1 |
| InChIKey | OBSYBRPAKCASQB-AGQYDFLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia divinorum (ncbitaxon:28513) | - | PubMed (21338114) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | oneirogen Any substance that produces or enhances dream-like states of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvinorin A (CHEBI:67900) has role metabolite (CHEBI:25212) |
| salvinorin A (CHEBI:67900) has role oneirogen (CHEBI:146270) |
| salvinorin A (CHEBI:67900) is a organic heterotricyclic compound (CHEBI:26979) |
| salvinorin A (CHEBI:67900) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| (2S,4aR,6aR,7R,9S,10aS,10bR)-methyl 9-acetoxy-2-(furan-3-yl)-6a,10bdimethyl-4,10-dioxododecahydro-1H-benzo[f]isochromene-7-carboxylate | ChEBI |
| Divinorin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:83729-01-5 | ChemIDplus |
| Citations |
|---|