EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | COc1ccc(C(C)=O)cc1O |
| InChI | InChI=1S/C9H10O3/c1-6(10)7-3-4-9(12-2)8(11)5-7/h3-5,11H,1-2H3 |
| InChIKey | YLTGFGDODHXMFB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoacetovanillone (CHEBI:67899) has role metabolite (CHEBI:25212) |
| isoacetovanillone (CHEBI:67899) is a methoxybenzenes (CHEBI:51683) |
| isoacetovanillone (CHEBI:67899) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-4-methoxyacetophenone | ChEBI |
| 1-(3-Hydroxy-4-methoxyphenyl)ethanone | ChEBI |
| Citations |
|---|