EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | COC(=O)c1c(C)cc(O)cc1O |
| InChI | InChI=1S/C9H10O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h3-4,10-11H,1-2H3 |
| InChIKey | NCCWCZLEACWJIN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orsellinic acid methyl ester (CHEBI:67898) has role metabolite (CHEBI:25212) |
| orsellinic acid methyl ester (CHEBI:67898) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonyms | Source |
|---|---|
| Benzoic acid, 2,4-dihydroxy-6-methyl-, methyl ester | ChEBI |
| Methyl 4,6-dihydroxy-2-methylbenzoate | ChEBI |
| Citations |
|---|