EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O5 |
| Net Charge | 0 |
| Average Mass | 300.310 |
| Monoisotopic Mass | 300.09977 |
| SMILES | Cc1c(O)c(C)c2c(c1O)C(=O)C[C@@H](c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C17H16O5/c1-8-15(20)9(2)17-14(16(8)21)12(19)7-13(22-17)10-3-5-11(18)6-4-10/h3-6,13,18,20-21H,7H2,1-2H3/t13-/m0/s1 |
| InChIKey | DYHOLQACRGJEHX-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farrerol (CHEBI:67897) has role metabolite (CHEBI:25212) |
| farrerol (CHEBI:67897) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Farrerol | KEGG COMPOUND |
| (S)-2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-4-benzopyrone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:24211-30-1 | KEGG COMPOUND |
| CAS:24211-30-1 | ChemIDplus |
| Citations |
|---|