EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O4/c1-18-9-14-30(25(33)34)16-15-28(5)20(24(30)19(18)2)7-8-22-26(3)12-11-23(32)27(4,17-31)21(26)10-13-29(22,28)6/h7,18-19,21-24,31-32H,8-17H2,1-6H3,(H,33,34)/t18-,19+,21-,22-,23+,24+,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | NZCULBURCGAPSF-PQWKYGPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cussonia bancoensis (IPNI:90140-1) | stem (BTO:0001300) | PubMed (21443171) | Previous component: stem bark; |
| Juglans sinensis (ncbitaxon:442437-1) | |||
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| Lagerstroemia speciosa (ncbitaxon:122810) | leaf (BTO:0000713) | PubMed (21443171) | |
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23-hydroxyursolic acid (CHEBI:67896) has functional parent ursolic acid (CHEBI:9908) |
| 23-hydroxyursolic acid (CHEBI:67896) has parent hydride ursane (CHEBI:35711) |
| 23-hydroxyursolic acid (CHEBI:67896) has role plant metabolite (CHEBI:76924) |
| 23-hydroxyursolic acid (CHEBI:67896) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 23-hydroxyursolic acid (CHEBI:67896) is a pentacyclic triterpenoid (CHEBI:25872) |
| 23-hydroxyursolic acid (CHEBI:67896) is conjugate acid of 23-hydroxyursolate (CHEBI:234082) |
| Incoming Relation(s) |
| 3β,23-dihydroxyurs-12-en-28-oic acid 28-O-β-D-glucopyranoside (CHEBI:67943) has functional parent 23-hydroxyursolic acid (CHEBI:67896) |
| 23-hydroxyursolate (CHEBI:234082) is conjugate base of 23-hydroxyursolic acid (CHEBI:67896) |
| IUPAC Name |
|---|
| 3β,23-dihydroxyurs-12-en-28-oic acid |
| Synonym | Source |
|---|---|
| 2-deoxyasiatic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5776876 | Reaxys |
| Citations |
|---|