EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h8,17-18,20-24,31-32H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
| InChIKey | HFGSQOYIOKBQOW-ZSDYHTTISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eriobotrya japonica (ncbitaxon:32224) | leaf (BTO:0000713) | PubMed (21443171) | |
| Euscaphis japonica (ncbitaxon:210332) | twig (BTO:0001411) | DOI (10.1021/np1003593) | 95% ethanolic extract of twigs |
| Juglans sinensis (ncbitaxon:442437-1) | |||
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| Prunus zippeliana (ncbitaxon:232787) | leaf (BTO:0000713) | PubMed (21443171) | |
| Rhododendron (ncbitaxon:4346) | - | PubMed (21443171) | |
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Symplocos lancifolia (ncbitaxon:239704) | leaf (BTO:0000713) | PubMed (21288041) | Dried, powdered leaves extracted with boiling 80% methanol |
| Tiarella polyphylla (ncbitaxon:61222) | leaf (BTO:0000713) | PubMed (21443171) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corosolic acid (CHEBI:67895) has role metabolite (CHEBI:25212) |
| corosolic acid (CHEBI:67895) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| 2alpha-Hydroxyursolic acid | ChEBI |
| Colosic acid | ChEBI |
| Corosolic acid | ChEBI |
| Glucosol | ChEBI |
| Urs-12-en-28-oic acid, 2,3-dihydroxy-, (2alpha,3beta)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:4547-24-4 | ChemIDplus |
| Citations |
|---|