EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | C=C(C)C(O)CCC(=C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(C)cc1O |
| InChI | InChI=1S/C22H30O3/c1-13(2)19(23)9-7-16(5)17-8-6-14(3)10-18(17)22-20(24)11-15(4)12-21(22)25/h10-12,17-19,23-25H,1,5-9H2,2-4H3/t17-,18+,19?/m0/s1 |
| InChIKey | LQECQNLKIZLVSL-PAMZHZACSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves(DIASTEREOMERIC MIXTURE AT C-5') |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferruginene C (CHEBI:67893) has role metabolite (CHEBI:25212) |
| ferruginene C (CHEBI:67893) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 2-[(1R,6R)-6-(5-Hydroxy-6-methyl-1,6-heptadien-2-yl)-3-methyl-2-cyclohexen-1-yl]-5-methyl-1,3-benzenediol | ChEBI |
| Citations |
|---|