EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | [H][C@]12Oc3cc(C)cc(O)c3[C@@]1([H])[C@H](C(=C)C/C=C/C(C)(C)O)CC[C@]2(C)O |
| InChI | InChI=1S/C22H30O4/c1-13-11-16(23)19-17(12-13)26-20-18(19)15(8-10-22(20,5)25)14(2)7-6-9-21(3,4)24/h6,9,11-12,15,18,20,23-25H,2,7-8,10H2,1,3-5H3/b9-6+/t15-,18+,20-,22-/m0/s1 |
| InChIKey | ZOCFYPAYCMVCQS-QOACGZPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferruginene B, (rel)- (CHEBI:67892) has role metabolite (CHEBI:25212) |
| ferruginene B, (rel)- (CHEBI:67892) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-(5aS,6S,9R,9aR)-9-[(4E)-6-Hydroxy-6-methyl-1,4-heptadien-2-yl]-3,6-dimethyl-5a,6,7,8,9,9a-hexahydrodibenzo[b,d]furan-1,6-diol | ChEBI |
| Citations |
|---|