EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | [H][C@]12Oc3cc(C)cc(O)c3[C@@]1([H])[C@H](C(=C)CCC(O)C(=C)C)CC[C@]2(C)O |
| InChI | InChI=1S/C22H30O4/c1-12(2)16(23)7-6-14(4)15-8-9-22(5,25)21-19(15)20-17(24)10-13(3)11-18(20)26-21/h10-11,15-16,19,21,23-25H,1,4,6-9H2,2-3,5H3/t15-,16?,19+,21-,22-/m0/s1 |
| InChIKey | VEMLNKJUTGWLOB-GKZIPKGRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferruginene A, (rel)- (CHEBI:67891) has role metabolite (CHEBI:25212) |
| ferruginene A, (rel)- (CHEBI:67891) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-(5aS,6S,9R,9aR)-9-(5-Hydroxy-6-methyl-1,6-heptadien-2-yl)-3,6-dimethyl-5a,6,7,8,9,9a-hexahydrodibenzo[b,d]furan-1,6-diol | ChEBI |
| Citations |
|---|