EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O2 |
| Net Charge | 0 |
| Average Mass | 252.313 |
| Monoisotopic Mass | 252.11503 |
| SMILES | C=C[C@H](/C=C\c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H16O2/c1-2-14(15-7-11-17(19)12-8-15)6-3-13-4-9-16(18)10-5-13/h2-12,14,18-19H,1H2/b6-3-/t14-/m1/s1 |
| InChIKey | VEAUNWQYYMXIRB-JHAQOBCDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anemarrhena asphodeloides (ncbitaxon:59045) | rhizome (BTO:0001181) | PubMed (21370894) | Methanolic extract of rhizomes |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-nyasol (CHEBI:67889) has role plant metabolite (CHEBI:76924) |
| (−)-nyasol (CHEBI:67889) is a 1,3-bis(p-hydroxyphenyl)pentane-1,4-diene (CHEBI:131953) |
| (−)-nyasol (CHEBI:67889) is enantiomer of (+)-nyasol (CHEBI:131956) |
| Incoming Relation(s) |
| (+)-nyasol (CHEBI:131956) is enantiomer of (−)-nyasol (CHEBI:67889) |
| IUPAC Name |
|---|
| 4-[(1Z,3R)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenol |
| Synonyms | Source |
|---|---|
| (1Z,3R)-4,4'-(3-ethenyl-1-propene-1,3-diyl)-bisphenol | ChEBI |
| (1Z,3R)-(−)-nyasol | ChEBI |
| (1Z,3R)-nyasol | ChEBI |
| (3R)-(−)-nyasol | ChEBI |
| (3R)-nyasol | ChEBI |
| (−)-4-[(1Z,3R)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:96895-25-9 | ChemIDplus |
| Citations |
|---|