EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CC[C@@H]1OC(C)(CC)O[C@H]1C |
| InChI | InChI=1S/C9H18O2/c1-5-8-7(3)10-9(4,6-2)11-8/h7-8H,5-6H2,1-4H3/t7-,8-,9?/m0/s1 |
| InChIKey | DYKULMLBPARQTH-JVIMKECRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triatoma brasiliensis (ncbitaxon:65344) | gland (BTO:0000522) | PubMed (21486009) | Trans compound isolated from metasternal glands |
| Triatoma infestans (ncbitaxon:30076) | gland (BTO:0000522) | PubMed (21486009) | metasternal glands |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-(2R/S)-2,4-diethyl-2,5-dimethyl-1,3-dioxolane (CHEBI:67881) has role metabolite (CHEBI:25212) |
| trans-(2R/S)-2,4-diethyl-2,5-dimethyl-1,3-dioxolane (CHEBI:67881) is a dioxolane (CHEBI:39430) |
| Citations |
|---|