EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O7 |
| Net Charge | 0 |
| Average Mass | 364.394 |
| Monoisotopic Mass | 364.15220 |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)CCC[C@H](C)OC2=O |
| InChI | InChI=1S/C19H24O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h4,6,9-11,15,18,21-23H,3,5,7-8H2,1-2H3/b6-4+/t11-,15-,18+/m0/s1 |
| InChIKey | WFIUAGOQGGAREU-XZUJVHTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cochliobolus lunatus (ncbitaxon:5503) | - | PubMed (21348465) | EtOAc extract, fungus isolated from gorgonian coral Dichotella gemmacea |
| Fungi | - | PubMed (21513293) | MeOH-CHCl3(1:1) extract of Mycosynthetix fungus isolated from leaflitter Strain: MSX 63935 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LL-Z1640-1 (CHEBI:67866) has role metabolite (CHEBI:25212) |
| LL-Z1640-1 (CHEBI:67866) is a macrolide (CHEBI:25106) |
| LL-Z1640-1 (CHEBI:67866) is a resorcinols (CHEBI:33572) |
| Synonym | Source |
|---|---|
| (2E,5S,6S,11S)-5,6,15-trihydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,15,17-tetraene-7,13-dione | ChEBI |
| Citations |
|---|