EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O6 |
| Net Charge | 0 |
| Average Mass | 420.461 |
| Monoisotopic Mass | 420.15729 |
| SMILES | CC(C)=CCc1c(-c2ccc(O)cc2O)oc2cc3c(c(O)c2c1=O)C=CC(C)(C)O3 |
| InChI | InChI=1S/C25H24O6/c1-13(2)5-7-17-23(29)21-20(30-24(17)15-8-6-14(26)11-18(15)27)12-19-16(22(21)28)9-10-25(3,4)31-19/h5-6,8-12,26-28H,7H2,1-4H3 |
| InChIKey | XIWCDUHPYMOFIL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paulownia tomentosa (ncbitaxon:39353) | fruit (BTO:0000486) | PubMed (21319773) | |
| Morus alba (ncbitaxon:3498) | |||
| bark (BTO:0001301) | PubMed (21319773) | CHCl3 soluble fraction of ethanolic extract of dried roots and aqueous extracts of leaves and bark | |
| leaf (BTO:0000713) | PubMed (21319773) | CHCl3 soluble fraction of ethanolic extract of dried roots and aqueous extracts of leaves and bark | |
| root (BTO:0001188) | PubMed (21319773) | CHCl3 soluble fraction of ethanolic extract of dried roots and aqueous extracts of leaves and bark | |
| Morus (ncbitaxon:3497) | - | PubMed (21319773) | |
| Cudrania tricuspidata (ncbitaxon:210328) | root (BTO:0001188) | PubMed (21319773) | Previous component: root bark; |
| Artocarpus (ncbitaxon:3488) | - | PubMed (21319773) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cudraflavone B (CHEBI:67850) has role anti-inflammatory agent (CHEBI:67079) |
| cudraflavone B (CHEBI:67850) has role plant metabolite (CHEBI:76924) |
| cudraflavone B (CHEBI:67850) is a extended flavonoid (CHEBI:71037) |
| cudraflavone B (CHEBI:67850) is a pyranochromane (CHEBI:74632) |
| cudraflavone B (CHEBI:67850) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 8-(2,4-dihydroxyphenyl)-5-hydroxy-2,2-dimethyl-7-(3-methylbut-2-en-1-yl)-2H,6H-pyrano[3,2-g]chromen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1442331 | Reaxys |
| Citations |
|---|