EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | COc1cc(O)c2c(=O)c3cccc(O)c3oc2c1 |
| InChI | InChI=1S/C14H10O5/c1-18-7-5-10(16)12-11(6-7)19-14-8(13(12)17)3-2-4-9(14)15/h2-6,15-16H,1H3 |
| InChIKey | IQIGECASJMDDMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mesua ferrea (ncbitaxon:210380) | - | DOI (10.1016/S0040-4020(01)83306-8) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesuaxanthone A (CHEBI:6785) has role plant metabolite (CHEBI:76924) |
| mesuaxanthone A (CHEBI:6785) is a aromatic ether (CHEBI:35618) |
| mesuaxanthone A (CHEBI:6785) is a polyphenol (CHEBI:26195) |
| mesuaxanthone A (CHEBI:6785) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,5-dihydroxy-3-methoxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,5-Dihydroxy-3-methoxyxanthone | KEGG COMPOUND |