EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O6 |
| Net Charge | 0 |
| Average Mass | 428.525 |
| Monoisotopic Mass | 428.21989 |
| SMILES | [H][C@]12Cc3c(O)cc4c(c3O[C@@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C)COC4=O |
| InChI | InChI=1S/C25H32O6/c1-13(26)30-20-7-8-24(4)18(23(20,2)3)6-9-25(5)19(24)11-15-17(27)10-14-16(21(15)31-25)12-29-22(14)28/h10,18-20,27H,6-9,11-12H2,1-5H3/t18-,19+,20-,24-,25-/m0/s1 |
| InChIKey | BOVRDZLKBBUXQQ-BOWIAGTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis archeri (fungorum:113952) | mycelium (BTO:0001436) | PubMed (21341709) | Endophytic fungus isolated from cortex stem of Vanilla albidia and combined Mycelial extract |
| Stachybotrys kampalensis (ncbitaxon:80389) | - | PubMed (21341709) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kampanol A (CHEBI:67848) has role metabolite (CHEBI:25212) |
| kampanol A (CHEBI:67848) is a hydroxyisoflavans (CHEBI:76250) |
| Synonym | Source |
|---|---|
| (6aR,6bS,9S,10aR,12aS)-5-hydroxy-6b,10,10,12a-tetramethyl-3-oxo-3,6,6a,6b,7,8,9,10,10a,11,12,12a-dodecahydro-1H-benzo[a]furo[3,4-h]xanthen-9-yl acetate | ChEBI |
| Citations |
|---|