EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O4 |
| Net Charge | 0 |
| Average Mass | 370.489 |
| Monoisotopic Mass | 370.21441 |
| SMILES | [H][C@]12Cc3c(O)cc(C)c(C=O)c3O[C@@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C23H30O4/c1-13-10-16(25)14-11-18-22(4)8-7-19(26)21(2,3)17(22)6-9-23(18,5)27-20(14)15(13)12-24/h10,12,17-18,25H,6-9,11H2,1-5H3/t17-,18+,22-,23-/m0/s1 |
| InChIKey | JDDYDTDIIFQNAG-WKZKVMAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis archeri (fungorum:113952) | mycelium (BTO:0001436) | PubMed (21341709) | Endophytic fungus isolated from cortex stem of Vanilla albidia and combined Mycelial extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomoarcherin C (CHEBI:67847) has role metabolite (CHEBI:25212) |
| Phomoarcherin C (CHEBI:67847) is a hydroxyisoflavans (CHEBI:76250) |
| Synonym | Source |
|---|---|
| (4aR,6aS,12aR,12bS)-11-hydroxy-4,4,6a,9,12b-pentamethyl-3-oxo-2,4a,5,6,12,12a-hexahydro-1H-benzo[a]xanthene-8-carbaldehyde | ChEBI |
| Citations |
|---|