EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O5 |
| Net Charge | 0 |
| Average Mass | 384.472 |
| Monoisotopic Mass | 384.19367 |
| SMILES | [H][C@]12Cc3c(O)cc4c(c3O[C@@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C)COC4=O |
| InChI | InChI=1S/C23H28O5/c1-21(2)16-5-8-23(4)17(22(16,3)7-6-18(21)25)10-13-15(24)9-12-14(19(13)28-23)11-27-20(12)26/h9,16-17,24H,5-8,10-11H2,1-4H3/t16-,17+,22-,23-/m0/s1 |
| InChIKey | YHFZNBXTQFHWGR-TXKCWOHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis archeri (fungorum:113952) | mycelium (BTO:0001436) | PubMed (21341709) | Endophytic fungus isolated from cortex stem of Vanilla albidia and combined Mycelial extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomoarcherin B (CHEBI:67846) has role metabolite (CHEBI:25212) |
| Phomoarcherin B (CHEBI:67846) is a hydroxyisoflavans (CHEBI:76250) |
| Synonym | Source |
|---|---|
| (6aR,6bS,10aR,12aS)-5-Hydroxy-6b,10,10,12a-tetramethyl-6a,7,8,10,10a,11,12,12a-octahydro-1H-benzo[a]furo[3,4-h]xanthene-3,9(6H,6bH)-dione | ChEBI |
| Citations |
|---|