EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@]12CC[C@@](C)(O)[C@]1([H])[C@@]1([H])C(C)(C)[C@@]1([H])CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O2/c1-13(2)9-5-7-14(3,16)10-6-8-15(4,17)12(10)11(9)13/h9-12,16-17H,5-8H2,1-4H3/t9-,10-,11-,12-,14-,15+/m0/s1 |
| InChIKey | DWNPMJOWAWGIMM-KPRRGPHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plagiochila ovalifolia (ncbitaxon:236197) | - | PubMed (21384863) | |
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-4beta,10alpha-dihydroxyaromadendrane (CHEBI:67837) has role metabolite (CHEBI:25212) |
| ent-4beta,10alpha-dihydroxyaromadendrane (CHEBI:67837) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1aS,4S,4aS,7R,7aR,7bS)-1,1,4,7-Tetramethyldecahydro-1H-cyclopropa[e]azulene-4,7-diol | ChEBI |
| Citations |
|---|