EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | [H][C@]12C(C)(C)[C@@]1([H])CCC(=C)[C@@]1([H])CC[C@@](C)(O)[C@]21[H] |
| InChI | InChI=1S/C15H24O/c1-9-5-6-11-13(14(11,2)3)12-10(9)7-8-15(12,4)16/h10-13,16H,1,5-8H2,2-4H3/t10-,11+,12+,13+,15-/m1/s1 |
| InChIKey | FRMCCTDTYSRUBE-HYFYGGESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Porella densifolia (ncbitaxon:446154) | - | PubMed (21384863) | |
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-spathulenol (CHEBI:67836) has role metabolite (CHEBI:25212) |
| ent-spathulenol (CHEBI:67836) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1aS,4aS,7R,7aS,7bS)-1,1,7-Trimethyl-4-methylenedecahydro-1H-cyclopropa[e]azulen-7-ol | ChEBI |
| Citations |
|---|