EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | COC(=O)[C@@]12Cc3occc3C(=O)[C@]1(C)CC[C@H]2C |
| InChI | InChI=1S/C15H18O4/c1-9-4-6-14(2)12(16)10-5-7-19-11(10)8-15(9,14)13(17)18-3/h5,7,9H,4,6,8H2,1-3H3/t9-,14+,15+/m1/s1 |
| InChIKey | HKOZPZRWAYCCLH-NKZPBKNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella (ncbitaxon:56942) | |||
| - | PubMed (21384863) | ||
| - | PubMed (21384863) | ||
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Porella densifolia (ncbitaxon:446154) | - | PubMed (21384863) | |
| Porella navicularis (ncbitaxon:269545) | - | PubMed (21384863) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norpinguisone methyl ester (CHEBI:67835) has role metabolite (CHEBI:25212) |
| norpinguisone methyl ester (CHEBI:67835) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| methyl (4aR,7R,7aR)-4a,7-dimethyl-4-oxo-5,6,7,8-tetrahydrocyclopenta[f][1]benzofuran-7a-carboxylate | ChEBI |
| Citations |
|---|