EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O4 |
| Net Charge | 0 |
| Average Mass | 276.332 |
| Monoisotopic Mass | 276.13616 |
| SMILES | CC(=O)OC[C@@]12Cc3occc3C(=O)[C@]1(C)CC[C@H]2C |
| InChI | InChI=1S/C16H20O4/c1-10-4-6-15(3)14(18)12-5-7-19-13(12)8-16(10,15)9-20-11(2)17/h5,7,10H,4,6,8-9H2,1-3H3/t10-,15+,16-/m1/s1 |
| InChIKey | IUFYKFUROQQFKO-HPEXNQPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Porella (ncbitaxon:56942) | - | PubMed (21384863) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norpinguisone acetate (CHEBI:67834) has role metabolite (CHEBI:25212) |
| norpinguisone acetate (CHEBI:67834) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| [(4aR,7R,7aR)-4a,7-Dimethyl-4-oxo-4,4a,5,6,7,8-hexahydro-7aH-indeno[5,6-b]furan-7a-yl]methyl acetate | ChEBI |
| Citations |
|---|