EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O2 |
| Net Charge | 0 |
| Average Mass | 204.269 |
| Monoisotopic Mass | 204.11503 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@]1(C)Cc1occc1C2=O |
| InChI | InChI=1S/C13H16O2/c1-8-3-4-10-12(14)9-5-6-15-11(9)7-13(8,10)2/h5-6,8,10H,3-4,7H2,1-2H3/t8-,10+,13+/m1/s1 |
| InChIKey | SVKFQPIEJUCJEM-DVYJOKAKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella (ncbitaxon:56942) | - | PubMed (21384863) | |
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Porella densifolia (ncbitaxon:446154) | - | PubMed (21384863) | |
| Porella navicularis (ncbitaxon:269545) | - | PubMed (21384863) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norpinguisone (CHEBI:67833) has role metabolite (CHEBI:25212) |
| norpinguisone (CHEBI:67833) is a benzofurans (CHEBI:35259) |
| Citations |
|---|