EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=C[C@@]1(O)CC[C@@]2(C)[C@H](C)CC[C@@]2(C)[C@@H]1C |
| InChI | InChI=1S/C15H26O/c1-6-15(16)10-9-13(4)11(2)7-8-14(13,5)12(15)3/h6,11-12,16H,1,7-10H2,2-5H3/t11-,12+,13+,14+,15-/m1/s1 |
| InChIKey | TUCSIUBDOHTKKQ-CAEXGNQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella acutifolia (ncbitaxon:460639) | - | PubMed (21384863) | |
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinguisenol (CHEBI:67832) has role metabolite (CHEBI:25212) |
| pinguisenol (CHEBI:67832) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1R,3aS,4S,5S,7aS)-5-ethenyl-1,3a,4,7a-tetramethyl-1,2,3,4,6,7-hexahydroinden-5-ol | ChEBI |
| Citations |
|---|