EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC[C@H](C)[C@]3(O)CC(=O)C(C)=C3C[C@@]1(C)CC[C@@H]2C(C)C |
| InChI | InChI=1S/C20H32O2/c1-12(2)15-8-9-19(5)10-17-14(4)18(21)11-20(17,22)13(3)6-7-16(15)19/h12-13,15-16,22H,6-11H2,1-5H3/t13-,15+,16-,19+,20+/m0/s1 |
| InChIKey | UHLQGMSCOUMZFU-UIGPTYSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusicoauritone (CHEBI:67831) has role metabolite (CHEBI:25212) |
| fusicoauritone (CHEBI:67831) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (3aR,4S,6aS,7R,9aR)-3a-Hydroxy-7-isopropyl-1,4,9a-trimethyl-3a,4,5,6,6a,7,8,9,9a,10-decahydrodicyclopenta[a,d][8]annulen-2(3H)-one | ChEBI |
| Citations |
|---|