EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC[C@H](C)C3=C(C[C@@]1(C)CC[C@@H]2C(C)C)[C@](C)(O)CC3=O |
| InChI | InChI=1S/C20H32O2/c1-12(2)14-8-9-19(4)10-16-18(13(3)6-7-15(14)19)17(21)11-20(16,5)22/h12-15,22H,6-11H2,1-5H3/t13-,14+,15-,19+,20+/m0/s1 |
| InChIKey | NXIQEZUWFNXIFV-YRYMLKIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Porella chilensis (ncbitaxon:462342) | - | PubMed (21384863) | The air-dried plant material was extracted with diethyl ether and then with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(1R,4S,6aS,7R,9aR)-1-Hydroxy-7-isopropyl-1,4,9a-trimethyl-1,4,5,6,6a,7,8,9,9a,10-decahydro-2H-dicyclopenta[a,d]cycloocten-3-one (CHEBI:67829) has role metabolite (CHEBI:25212) |
| rel-(1R,4S,6aS,7R,9aR)-1-Hydroxy-7-isopropyl-1,4,9a-trimethyl-1,4,5,6,6a,7,8,9,9a,10-decahydro-2H-dicyclopenta[a,d]cycloocten-3-one (CHEBI:67829) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|