EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O8 |
| Net Charge | 0 |
| Average Mass | 412.394 |
| Monoisotopic Mass | 412.11582 |
| SMILES | [H][C@]12OC=C[C@@]1(O)c1c(cc3oc4c(CCC(C)(C)O)ccc(O)c4c(=O)c3c1O)O2 |
| InChI | InChI=1S/C22H20O8/c1-21(2,26)6-5-10-3-4-11(23)14-17(24)15-12(29-19(10)14)9-13-16(18(15)25)22(27)7-8-28-20(22)30-13/h3-4,7-9,20,23,25-27H,5-6H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | VXTQFTUOAJRUDO-IFMALSPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (21348461) | Strain: UGM218 |
| Aspergillus ustus (ncbitaxon:40382) | - | PubMed (21348461) | Maize meal cultures of Aspergillus ustus |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| austocystin D (CHEBI:67827) has role Aspergillus metabolite (CHEBI:76956) |
| austocystin D (CHEBI:67827) has role antineoplastic agent (CHEBI:35610) |
| austocystin D (CHEBI:67827) is a cyclic ketone (CHEBI:3992) |
| austocystin D (CHEBI:67827) is a organic heteropentacyclic compound (CHEBI:38164) |
| austocystin D (CHEBI:67827) is a oxacycle (CHEBI:38104) |
| austocystin D (CHEBI:67827) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (3aR,12aR)-3a,4,6-trihydroxy-9-(3-hydroxy-3-methylbutyl)-3a,12a-dihydro-5H-furo[3',2':4,5]furo[3,2-b]xanthen-5-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5176992 | Reaxys |
| CAS:55256-53-6 | ChemIDplus |
| Citations |
|---|