EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O |
| Net Charge | 0 |
| Average Mass | 424.713 |
| Monoisotopic Mass | 424.37052 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC[C@@]4(C)CCC(C)(C)C[C@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H48O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-23H,10-19H2,1-8H3/t20-,22+,23+,27-,28-,29-,30+/m0/s1 |
| InChIKey | DBCAVZSSFGIHQZ-YLAYQGCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude n-hexane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taraxerone (CHEBI:67826) has role metabolite (CHEBI:25212) |
| taraxerone (CHEBI:67826) is a scalarane sesterterpenoid (CHEBI:59370) |
| Synonym | Source |
|---|---|
| D-Friedoolean-14-en-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:514-07-8 | ChemIDplus |
| Citations |
|---|