EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4([H])C(C)(C)C(=O)CC[C@]34C)[C@]1(C)CC[C@@]13O[C@]1(C(C)C)CC[C@]23C |
| InChI | InChI=1S/C30H48O2/c1-19(2)29-17-15-28(8)22-10-9-21-25(5)13-12-23(31)24(3,4)20(25)11-14-26(21,6)27(22,7)16-18-30(28,29)32-29/h19-22H,9-18H2,1-8H3/t20-,21+,22-,25-,26+,27+,28+,29-,30-/m0/s1 |
| InChIKey | CMWZPPYBIGXKPR-LPSJIVJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude n-hexane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β,21β-epoxyhopan-3-one (CHEBI:67825) has role plant metabolite (CHEBI:76924) |
| 17β,21β-epoxyhopan-3-one (CHEBI:67825) is a cyclic terpene ketone (CHEBI:36130) |
| 17β,21β-epoxyhopan-3-one (CHEBI:67825) is a epoxide (CHEBI:32955) |
| 17β,21β-epoxyhopan-3-one (CHEBI:67825) is a hopanoid (CHEBI:51963) |
| IUPAC Name |
|---|
| 17,21-epoxyhopan-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9169944 | Reaxys |
| Citations |
|---|