EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(CO)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H48O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-23,25,31H,1,8-18H2,2-7H3/t20-,21+,22-,23+,25+,27-,28+,29+,30+/m0/s1 |
| InChIKey | JYDNKGUBLIKNAM-CNRMHUMKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude n-hexane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betulone (CHEBI:67824) has parent hydride lupane (CHEBI:36485) |
| betulone (CHEBI:67824) has role metabolite (CHEBI:25212) |
| betulone (CHEBI:67824) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|