EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H40O9 |
| Net Charge | 0 |
| Average Mass | 556.652 |
| Monoisotopic Mass | 556.26723 |
| SMILES | CCCCCC(=O)Cc1cc(OC)cc(O)c1C(=O)Oc1cc(CC(=O)CCCCC)c(C(=O)OC)c(OC)c1 |
| InChI | InChI=1S/C31H40O9/c1-6-8-10-12-22(32)14-20-16-24(37-3)18-26(34)28(20)31(36)40-25-17-21(15-23(33)13-11-9-7-2)29(30(35)39-5)27(19-25)38-4/h16-19,34H,6-15H2,1-5H3 |
| InChIKey | FHOVJOXBAHBKGJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude n-hexane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gustastatin (CHEBI:67822) has role metabolite (CHEBI:25212) |
| gustastatin (CHEBI:67822) is a carbonyl compound (CHEBI:36586) |
| Synonym | Source |
|---|---|
| [3-methoxy-4-methoxycarbonyl-5-(2-oxoheptyl)phenyl]2-hydroxy-4-methoxy-6-(2-oxoheptyl)benzoate | ChEBI |
| Citations |
|---|